C30H60O2Si2 — CID 18636643
tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]nonan-3-yl]oxysilane (PubChem CID 18636643) has the molecular formula C30H60O2Si2 and a molecular weight of 508.98 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]nonan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]nonan-3-yl]oxysilane |
|---|---|
| PubChem CID | 18636643 |
| Molecular Formula | C30H60O2Si2 |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]nonan-3-yl]oxysilane |
| SMILES | C=CC[C@@H]1C(CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)CCCCC)=CC[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H60O2Si2/c1-12-17-18-20-25(6)28(31-33(10,11)30(7,8)9)23-21-26-22-24-29(27(26)19-13-2)32-34(14-3,15-4)16-5/h13,22,25,27-29H,2,12,14-21,23-24H2,1,3-11H3/t25?,27-,28+,29+/m1/s1 |
| InChIKey | XDNYJXDDZVQLDZ-VBABMKIZSA-N |
| XLogP | 10.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|