C29H58O2Si2 — CID 18636647
tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane (PubChem CID 18636647) has the molecular formula C29H58O2Si2 and a molecular weight of 494.95 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane |
|---|---|
| PubChem CID | 18636647 |
| Molecular Formula | C29H58O2Si2 |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.40 |
| IUPAC Name | tert-butyl-dimethyl-[(3S)-4-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane |
| SMILES | C=CC[C@@H]1C(CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)CCCC)=CC[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H58O2Si2/c1-12-17-19-24(6)27(30-32(10,11)29(7,8)9)22-20-25-21-23-28(26(25)18-13-2)31-33(14-3,15-4)16-5/h13,21,24,26-28H,2,12,14-20,22-23H2,1,3-11H3/t24?,26-,27+,28+/m1/s1 |
| InChIKey | QCRLJGBYSIFOKC-PERJUXLTSA-N |
| XLogP | 9.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|