C20H30O4 — CID 18636712
7-[(1R)-2-[(3R)-3-hydroxyoctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636712) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 7-[(1R)-2-[(3R)-3-hydroxyoctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R)-2-[(3R)-3-hydroxyoctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18636712 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 7-[(1R)-2-[(3R)-3-hydroxyoctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCC[C@@H](O)CCC1=CCC(=O)[C@@H]1CCC=C=CCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,8,13,17-18,21H,2-3,6-7,9-12,14-15H2,1H3,(H,23,24)/t5?,17-,18-/m1/s1 |
| InChIKey | KNHFTMKQZPLRHQ-RPXDDSDZSA-N |
| XLogP | 4.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|