C32H60O4Si2 — CID 18636781
7-[(1R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636781) has the molecular formula C32H60O4Si2 and a molecular weight of 565.00 g/mol. Its IUPAC name is 7-[(1R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18636781 |
| Molecular Formula | C32H60O4Si2 |
| Molecular Weight | 565.00 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | 7-[(1R,5S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCC[C@H](CCC1=CC[C@H](O[Si](CC)(CC)CC)[C@@H]1CCC=C=CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60O4Si2/c1-10-14-17-20-28(35-37(8,9)32(5,6)7)25-23-27-24-26-30(36-38(11-2,12-3)13-4)29(27)21-18-15-16-19-22-31(33)34/h15,19,24,28-30H,10-14,17-18,20-23,25-26H2,1-9H3,(H,33,34)/t16?,28-,29-,30+/m1/s1 |
| InChIKey | AKPBEKBPPWWQFS-IKQJWADUSA-N |
| XLogP | 10.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.00 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|