C28H48O4Si — CID 18636846
7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636846) has the molecular formula C28H48O4Si and a molecular weight of 476.77 g/mol. Its IUPAC name is 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18636846 |
| Molecular Formula | C28H48O4Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CC(CCC1=CC[C@H](O)[C@@H]1CCC=C=CCC(=O)O)(O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C28H48O4Si/c1-27(2,3)33(5,6)32-28(4,23-14-10-9-11-15-23)21-20-22-18-19-25(29)24(22)16-12-7-8-13-17-26(30)31/h7,13,18,23-25,29H,9-12,14-17,19-21H2,1-6H3,(H,30,31)/t8?,24-,25+,28?/m1/s1 |
| InChIKey | RZHYQHOBWKUHDU-ZULBRBBJSA-N |
| XLogP | 7.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|