C27H46O4Si — CID 18636873
7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636873) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18636873 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCC(C)C(CCC1=CCC(=O)[C@@H]1CCC=C=CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O4Si/c1-8-9-14-21(2)25(31-32(6,7)27(3,4)5)20-18-22-17-19-24(28)23(22)15-12-10-11-13-16-26(29)30/h10,13,17,21,23,25H,8-9,12,14-16,18-20H2,1-7H3,(H,29,30)/t11?,21?,23-,25?/m1/s1 |
| InChIKey | YAZBKCPEOKGSOE-QVHVBZHNSA-N |
| XLogP | 7.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|