C26H43F3O4Si — CID 18637015
7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18637015) has the molecular formula C26H43F3O4Si and a molecular weight of 504.71 g/mol. Its IUPAC name is 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18637015 |
| Molecular Formula | C26H43F3O4Si |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCC(F)(F)F)CCC1=CCC(O)[C@@H]1CCC=C=CCC(=O)O |
| InChI | InChI=1S/C26H43F3O4Si/c1-25(2,3)34(4,5)33-21(12-10-11-19-26(27,28)29)17-15-20-16-18-23(30)22(20)13-8-6-7-9-14-24(31)32/h6,9,16,21-23,30H,8,10-15,17-19H2,1-5H3,(H,31,32)/t7?,21?,22-,23?/m1/s1 |
| InChIKey | RTDFHNKHSGPFME-HLWDFOANSA-N |
| XLogP | 7.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|