C20H27F3O4 — CID 18637017
7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18637017) has the molecular formula C20H27F3O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is 7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18637017 |
| Molecular Formula | C20H27F3O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | O=C(O)CC=C=CCC[C@H]1C(=O)CC=C1CCC(O)CCCCC(F)(F)F |
| InChI | InChI=1S/C20H27F3O4/c21-20(22,23)14-6-5-7-16(24)12-10-15-11-13-18(25)17(15)8-3-1-2-4-9-19(26)27/h1,4,11,16-17,24H,3,5-10,12-14H2,(H,26,27)/t2?,16?,17-/m1/s1 |
| InChIKey | ZQPFGHKAHNNWMV-UJVGCSLSSA-N |
| XLogP | 4.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|