C34H62O4Si2 — CID 18637024
7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18637024) has the molecular formula C34H62O4Si2 and a molecular weight of 591.04 g/mol. Its IUPAC name is 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18637024 |
| Molecular Formula | C34H62O4Si2 |
| Molecular Weight | 591.04 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | 7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CC[Si](CC)(CC)OC1CC=C(CCC(C)(O[Si](C)(C)C(C)(C)C)C2CCCCC2)[C@H]1CCC=C=CCC(=O)O |
| InChI | InChI=1S/C34H62O4Si2/c1-10-40(11-2,12-3)37-31-25-24-28(30(31)22-18-13-14-19-23-32(35)36)26-27-34(7,29-20-16-15-17-21-29)38-39(8,9)33(4,5)6/h13,19,24,29-31H,10-12,15-18,20-23,25-27H2,1-9H3,(H,35,36)/t14?,30-,31?,34?/m1/s1 |
| InChIKey | WAZQILYAHWOONC-WAHWDLIUSA-N |
| XLogP | 10.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.04 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|