C14H29NO6 — CID 18637304
(2R,3S,4R,5R)-N-(2-ethylhexyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 18637304) has the molecular formula C14H29NO6 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-(2-ethylhexyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-N-(2-ethylhexyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 18637304 |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (2R,3S,4R,5R)-N-(2-ethylhexyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CCCCC(CC)CNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H29NO6/c1-3-5-6-9(4-2)7-15-14(21)13(20)12(19)11(18)10(17)8-16/h9-13,16-20H,3-8H2,1-2H3,(H,15,21)/t9?,10-,11-,12+,13-/m1/s1 |
| InChIKey | GUBOZUXRNZWHIW-FOMPKITHSA-N |
| XLogP | -1.25 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |