C31H44ClN3O3 — CID 18637480
4-(aminomethyl)-N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 18637480) has the molecular formula C31H44ClN3O3 and a molecular weight of 542.16 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18637480 |
| Molecular Formula | C31H44ClN3O3 |
| Molecular Weight | 542.16 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 4-(aminomethyl)-N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC1CCC(NC(=O)[C@H](Cc2ccc(OCc3ccccc3)cc2)NC(=O)C2CCC(CN)CC2)CC1.Cl |
| InChI | InChI=1S/C31H43N3O3.ClH/c1-22-7-15-27(16-8-22)33-31(36)29(34-30(35)26-13-9-24(20-32)10-14-26)19-23-11-17-28(18-12-23)37-21-25-5-3-2-4-6-25;/h2-6,11-12,17-18,22,24,26-27,29H,7-10,13-16,19-21,32H2,1H3,(H,33,36)(H,34,35);1H/t22?,24?,26?,27?,29-;/m0./s1 |
| InChIKey | BHXHWQPWEVBDBN-UXZFSPKESA-N |
| XLogP | 5.17 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.16 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |