C15H21FO7 — CID 18637692
(3R,4S,5R,6R)-5-fluoro-6-(hydroxymethyl)-4-[1-(4-methoxyphenyl)ethoxy]oxane-2,3,5-triol (PubChem CID 18637692) has the molecular formula C15H21FO7 and a molecular weight of 332.32 g/mol. Its IUPAC name is (3R,4S,5R,6R)-5-fluoro-6-(hydroxymethyl)-4-[1-(4-methoxyphenyl)ethoxy]oxane-2,3,5-triol.
| Compound Name | (3R,4S,5R,6R)-5-fluoro-6-(hydroxymethyl)-4-[1-(4-methoxyphenyl)ethoxy]oxane-2,3,5-triol |
|---|---|
| PubChem CID | 18637692 |
| Molecular Formula | C15H21FO7 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (3R,4S,5R,6R)-5-fluoro-6-(hydroxymethyl)-4-[1-(4-methoxyphenyl)ethoxy]oxane-2,3,5-triol |
| SMILES | COc1ccc(C(C)O[C@H]2[C@@H](O)C(O)O[C@H](CO)[C@@]2(O)F)cc1 |
| InChI | InChI=1S/C15H21FO7/c1-8(9-3-5-10(21-2)6-4-9)22-13-12(18)14(19)23-11(7-17)15(13,16)20/h3-6,8,11-14,17-20H,7H2,1-2H3/t8?,11-,12-,13+,14?,15+/m1/s1 |
| InChIKey | LLJPEAKMNJWCCE-INSZFBPISA-N |
| XLogP | -0.13 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |