C15H27N3O3 — CID 18637736
(2S,4S,5S)-5-azido-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanoic acid (PubChem CID 18637736) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2S,4S,5S)-5-azido-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanoic acid.
| Compound Name | (2S,4S,5S)-5-azido-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanoic acid |
|---|---|
| PubChem CID | 18637736 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (2S,4S,5S)-5-azido-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanoic acid |
| SMILES | CC(C)[C@H](C[C@H](O)[C@H](CC1CCCCC1)N=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C15H27N3O3/c1-10(2)12(15(20)21)9-14(19)13(17-18-16)8-11-6-4-3-5-7-11/h10-14,19H,3-9H2,1-2H3,(H,20,21)/t12-,13-,14-/m0/s1 |
| InChIKey | BDPADCJBVXKOFS-IHRRRGAJSA-N |
| XLogP | 3.74 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|