C29H34O2S — CID 18637784
(8S,11R,13S,14S)-11-(4-ethylsulfanylphenyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one (PubChem CID 18637784) has the molecular formula C29H34O2S and a molecular weight of 446.66 g/mol. Its IUPAC name is (8S,11R,13S,14S)-11-(4-ethylsulfanylphenyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one.
| Compound Name | (8S,11R,13S,14S)-11-(4-ethylsulfanylphenyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one |
|---|---|
| PubChem CID | 18637784 |
| Molecular Formula | C29H34O2S |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (8S,11R,13S,14S)-11-(4-ethylsulfanylphenyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one |
| SMILES | CCSc1ccc([C@H]2C[C@@]3(C)[C@@H](CCC34C=CCO4)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C29H34O2S/c1-3-32-22-9-5-19(6-10-22)25-18-28(2)26(13-15-29(28)14-4-16-31-29)24-11-7-20-17-21(30)8-12-23(20)27(24)25/h4-6,9-10,14,17,24-26H,3,7-8,11-13,15-16,18H2,1-2H3/t24-,25+,26-,28-,29?/m0/s1 |
| InChIKey | VTRRRJOLNYJVII-OLPPVYEZSA-N |
| XLogP | 7.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|