C17H24O6 — CID 18638697
7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoic acid (PubChem CID 18638697) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoic acid.
| Compound Name | 7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 18638697 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoic acid |
| SMILES | CCCCC#CC(=O)[C@H]1OC(=O)O[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C17H24O6/c1-2-3-4-7-10-13(18)16-14(22-17(21)23-16)11-8-5-6-9-12-15(19)20/h14,16H,2-6,8-9,11-12H2,1H3,(H,19,20)/t14-,16+/m0/s1 |
| InChIKey | YTOZKXFMQYLWFE-GOEBONIOSA-N |
| XLogP | 3.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|