C22H36N2O5 — CID 18638746
tert-butyl (2R,3aR,6aR)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propanoyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 18638746) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is tert-butyl (2R,3aR,6aR)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propanoyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (2R,3aR,6aR)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propanoyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18638746 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | tert-butyl (2R,3aR,6aR)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propanoyl]-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCC[C@H](N[C@@H](C)C(=O)N1[C@@H](C(=O)OC(C)(C)C)C[C@H]2CC=C[C@@H]21)C(=O)OCC |
| InChI | InChI=1S/C22H36N2O5/c1-7-10-16(20(26)28-8-2)23-14(3)19(25)24-17-12-9-11-15(17)13-18(24)21(27)29-22(4,5)6/h9,12,14-18,23H,7-8,10-11,13H2,1-6H3/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | GOQYKQZAZDZFQV-FLXSYLCISA-N |
| XLogP | 2.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|