About (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride
(3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride (PubChem CID 18639209) has the molecular formula C16H30ClNO2
and a molecular weight of 303.87 g/mol. Its IUPAC name is (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride |
| PubChem CID | 18639209 |
| Molecular Formula | C16H30ClNO2 |
| Molecular Weight | 303.87 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride |
| SMILES | CC(C)C[C@@H]1C[C@@H]([C@@H](N)CC2CCCCC2)OC1=O.Cl |
| InChI | InChI=1S/C16H29NO2.ClH/c1-11(2)8-13-10-15(19-16(13)18)14(17)9-12-6-4-3-5-7-12;/h11-15H,3-10,17H2,1-2H3;1H/t13-,14+,15+;/m1./s1 |
| InChIKey | WKBYKJKTQAWQPT-DSMRVHDJSA-N |
| XLogP | 3.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride?
The IUPAC name of (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride (CID 18639209) is (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride.
What is the SMILES notation for (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride?
The canonical SMILES for (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride is CC(C)C[C@@H]1C[C@@H]([C@@H](N)CC2CCCCC2)OC1=O.Cl.
What is the InChIKey of (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride?
The InChIKey is WKBYKJKTQAWQPT-DSMRVHDJSA-N. The full InChI is InChI=1S/C16H29NO2.ClH/c1-11(2)8-13-10-15(19-16(13)18)14(17)9-12-6-4-3-5-7-12;/h11-15H,3-10,17H2,1-2H3;1H/t13-,14+,15+;/m1./s1.
What are the key properties of (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride?
(3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride has a molecular weight of 303.87 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-(2-methylpropyl)oxolan-2-one;hydrochloride is sourced from PubChem (CID 18639209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).