C29H45N5O5Si2 — CID 18639236
N-[9-[(2R,3R,4S,5R)-3,4-bis[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 18639236) has the molecular formula C29H45N5O5Si2 and a molecular weight of 599.88 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3,4-bis[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3,4-bis[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 18639236 |
| Molecular Formula | C29H45N5O5Si2 |
| Molecular Weight | 599.88 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-bis[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)[C@@]1(O)[C@@H](CO)O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@]1(O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H45N5O5Si2/c1-26(2,3)40(7,8)28(37)20(16-35)39-25(29(28,38)41(9,10)27(4,5)6)34-18-32-21-22(30-17-31-23(21)34)33-24(36)19-14-12-11-13-15-19/h11-15,17-18,20,25,35,37-38H,16H2,1-10H3,(H,30,31,33,36)/t20-,25-,28+,29-/m1/s1 |
| InChIKey | RPJHPXBVKTVPPS-OVTPQEIBSA-N |
| XLogP | 4.53 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|