C43H47N5O6Si — CID 18639237
N-[9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(1-methylperoxy-2,2,2-triphenylethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 18639237) has the molecular formula C43H47N5O6Si and a molecular weight of 757.96 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(1-methylperoxy-2,2,2-triphenylethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(1-methylperoxy-2,2,2-triphenylethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 18639237 |
| Molecular Formula | C43H47N5O6Si |
| Molecular Weight | 757.96 g/mol |
| Exact Mass | 757.33 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(1-methylperoxy-2,2,2-triphenylethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COOC([C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H47N5O6Si/c1-42(2,3)55(5,6)54-35-34(49)41(48-28-46-33-38(44-27-45-39(33)48)47-40(50)29-19-11-7-12-20-29)52-36(35)37(53-51-4)43(30-21-13-8-14-22-30,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h7-28,34-37,41,49H,1-6H3,(H,44,45,47,50)/t34-,35+,36+,37?,41-/m1/s1 |
| InChIKey | DLIWMJHYXSGHPI-RHTLODGISA-N |
| XLogP | 7.71 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.96 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|