C20H36O5Si — CID 18639356
(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid (PubChem CID 18639356) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid.
| Compound Name | (1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid |
|---|---|
| PubChem CID | 18639356 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid |
| SMILES | CC1(C)COC2(C[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C(=O)O)[C@@H]3C2)OC1 |
| InChI | InChI=1S/C20H36O5Si/c1-18(2,3)26(6,7)25-15-8-13-9-20(10-14(13)16(15)17(21)22)23-11-19(4,5)12-24-20/h13-16H,8-12H2,1-7H3,(H,21,22)/t13-,14+,15+,16+/m0/s1 |
| InChIKey | AELPYPQQAOXMQI-ZJIFWQFVSA-N |
| XLogP | 4.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|