C20H37NO6 — CID 18639391
tert-butyl N-[(E,4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate (PubChem CID 18639391) has the molecular formula C20H37NO6 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl N-[(E,4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate |
|---|---|
| PubChem CID | 18639391 |
| Molecular Formula | C20H37NO6 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | tert-butyl N-[(E,4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate |
| SMILES | CCC[C@H](NC(=O)OC(C)(C)C)[C@@H](O)/C=C(/CO)CCOC1CCCCO1 |
| InChI | InChI=1S/C20H37NO6/c1-5-8-16(21-19(24)27-20(2,3)4)17(23)13-15(14-22)10-12-26-18-9-6-7-11-25-18/h13,16-18,22-23H,5-12,14H2,1-4H3,(H,21,24)/b15-13+/t16-,17-,18?/m0/s1 |
| InChIKey | IBWGPFDJNNXZOA-PATVSADPSA-N |
| XLogP | 2.89 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|