About (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide
(2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide (PubChem CID 18639396) has the molecular formula C21H37N3O4
and a molecular weight of 395.54 g/mol. Its IUPAC name is (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide.
Molecular Properties
| Compound Name | (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide |
| PubChem CID | 18639396 |
| Molecular Formula | C21H37N3O4 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide |
| SMILES | C=CC(=O)NC(=O)[C@H](CCCCNC(=O)CCCCC)NC(=O)CCCCC |
| InChI | InChI=1S/C21H37N3O4/c1-4-7-9-14-19(26)22-16-12-11-13-17(21(28)24-18(25)6-3)23-20(27)15-10-8-5-2/h6,17H,3-5,7-16H2,1-2H3,(H,22,26)(H,23,27)(H,24,25,28)/t17-/m0/s1 |
| InChIKey | XTPJSMOXOYJNQG-KRWDZBQOSA-N |
| XLogP | 2.75 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide?
The IUPAC name of (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide (CID 18639396) is (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide.
What is the SMILES notation for (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide?
The canonical SMILES for (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide is C=CC(=O)NC(=O)[C@H](CCCCNC(=O)CCCCC)NC(=O)CCCCC.
What is the InChIKey of (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide?
The InChIKey is XTPJSMOXOYJNQG-KRWDZBQOSA-N. The full InChI is InChI=1S/C21H37N3O4/c1-4-7-9-14-19(26)22-16-12-11-13-17(21(28)24-18(25)6-3)23-20(27)15-10-8-5-2/h6,17H,3-5,7-16H2,1-2H3,(H,22,26)(H,23,27)(H,24,25,28)/t17-/m0/s1.
What are the key properties of (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide?
(2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide has a molecular weight of 395.54 g/mol, XLogP of 2.75, 16 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-bis(hexanoylamino)-N-prop-2-enoylhexanamide is sourced from PubChem (CID 18639396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).