C24H32O7S — CID 18639647
2-[2-[(6S,10R,13S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl]sulfanylacetic acid (PubChem CID 18639647) has the molecular formula C24H32O7S and a molecular weight of 464.58 g/mol. Its IUPAC name is 2-[2-[(6S,10R,13S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[(6S,10R,13S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 18639647 |
| Molecular Formula | C24H32O7S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-[2-[(6S,10R,13S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl]sulfanylacetic acid |
| SMILES | C[C@H]1CC2C(C(O)C[C@@]3(C)C2CC[C@]3(O)C(=O)C(O)SCC(=O)O)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C24H32O7S/c1-12-8-14-15-5-7-24(31,20(29)21(30)32-11-18(27)28)23(15,3)10-17(26)19(14)22(2)6-4-13(25)9-16(12)22/h4,6,9,12,14-15,17,19,21,26,30-31H,5,7-8,10-11H2,1-3H3,(H,27,28)/t12-,14?,15?,17?,19?,21?,22-,23-,24-/m0/s1 |
| InChIKey | CZEUZXYAEXGKEI-RNTDCZDXSA-N |
| XLogP | 1.95 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|