C10H17NO — CID 18639715
(4aR,9aS)-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridin-2-one (PubChem CID 18639715) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (4aR,9aS)-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridin-2-one.
| Compound Name | (4aR,9aS)-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridin-2-one |
|---|---|
| PubChem CID | 18639715 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4aR,9aS)-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[b]pyridin-2-one |
| SMILES | O=C1CC[C@H]2CCCCC[C@@H]2N1 |
| InChI | InChI=1S/C10H17NO/c12-10-7-6-8-4-2-1-3-5-9(8)11-10/h8-9H,1-7H2,(H,11,12)/t8-,9+/m1/s1 |
| InChIKey | QTPHCCMZFUGSJL-BDAKNGLRSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |