C29H40O6S — CID 18639897
(3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(2-methyl-2-phenylsulfanylpropanoyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 18639897) has the molecular formula C29H40O6S and a molecular weight of 516.70 g/mol. Its IUPAC name is (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(2-methyl-2-phenylsulfanylpropanoyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(2-methyl-2-phenylsulfanylpropanoyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 18639897 |
| Molecular Formula | C29H40O6S |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-(2-methyl-2-phenylsulfanylpropanoyl)oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@H]2[C@@H](OC(=O)C(C)(C)Sc2ccccc2)C1 |
| InChI | InChI=1S/C29H40O6S/c1-18-14-20-11-10-19(2)24(13-12-21(30)16-22(31)17-26(32)33)27(20)25(15-18)35-28(34)29(3,4)36-23-8-6-5-7-9-23/h5-11,14,18-19,21-22,24-25,27,30-31H,12-13,15-17H2,1-4H3,(H,32,33)/t18-,19-,21+,22+,24-,25-,27-/m0/s1 |
| InChIKey | FQDCHRYQHPMDRP-NBYLKSIASA-N |
| XLogP | 5.24 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |