C15H23N3 — CID 18640057
(5aS,9aS)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine (PubChem CID 18640057) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (5aS,9aS)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine.
| Compound Name | (5aS,9aS)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine |
|---|---|
| PubChem CID | 18640057 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (5aS,9aS)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine |
| SMILES | CCCN1CCC[C@H]2Cc3nc(N)ccc3C[C@@H]21 |
| InChI | InChI=1S/C15H23N3/c1-2-7-18-8-3-4-12-9-13-11(10-14(12)18)5-6-15(16)17-13/h5-6,12,14H,2-4,7-10H2,1H3,(H2,16,17)/t12-,14-/m0/s1 |
| InChIKey | MEXISCNKOYMTKI-JSGCOSHPSA-N |
| XLogP | 2.25 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |