C8H12O6 — CID 18640086
(3aR,6S,6aR)-6-(dihydroxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 18640086) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is (3aR,6S,6aR)-6-(dihydroxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6S,6aR)-6-(dihydroxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 18640086 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (3aR,6S,6aR)-6-(dihydroxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](C(O)O)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C8H12O6/c1-8(2)13-3-4(6(9)10)12-7(11)5(3)14-8/h3-6,9-10H,1-2H3/t3-,4+,5-/m1/s1 |
| InChIKey | MKLQKUXRGLIHJP-MROZADKFSA-N |
| XLogP | -1.26 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|