C24H36O6 — CID 18640157
[(1S,3S,8S,8aR)-3-(hydroxymethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]methyl (2S)-2-methylbutanoate (PubChem CID 18640157) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is [(1S,3S,8S,8aR)-3-(hydroxymethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]methyl (2S)-2-methylbutanoate.
| Compound Name | [(1S,3S,8S,8aR)-3-(hydroxymethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]methyl (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 18640157 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(1S,3S,8S,8aR)-3-(hydroxymethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]methyl (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)OC[C@H]1C[C@H](CO)C=C2C=CC[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]21 |
| InChI | InChI=1S/C24H36O6/c1-3-15(2)24(28)29-14-19-10-16(13-25)9-18-6-4-5-17(23(18)19)7-8-21-11-20(26)12-22(27)30-21/h4,6,9,15-17,19-21,23,25-26H,3,5,7-8,10-14H2,1-2H3/t15-,16+,17+,19+,20+,21+,23-/m0/s1 |
| InChIKey | XQMFYNRSXLFVOQ-PARKQEIZSA-N |
| XLogP | 3.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |