C27H41NO6 — CID 18640182
[[(1S,7S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbonyl]-methylamino]methyl 2,2-dimethylbutanoate (PubChem CID 18640182) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is [[(1S,7S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbonyl]-methylamino]methyl 2,2-dimethylbutanoate.
| Compound Name | [[(1S,7S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbonyl]-methylamino]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 18640182 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | [[(1S,7S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbonyl]-methylamino]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCN(C)C(=O)[C@H]1CCC=C2C=C[C@H](C)C(CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]21 |
| InChI | InChI=1S/C27H41NO6/c1-6-27(3,4)26(32)33-16-28(5)25(31)22-9-7-8-18-11-10-17(2)21(24(18)22)13-12-20-14-19(29)15-23(30)34-20/h8,10-11,17,19-22,24,29H,6-7,9,12-16H2,1-5H3/t17-,19+,20+,21?,22-,24+/m0/s1 |
| InChIKey | AUNIJYFMOLWBTE-FPEAGVSPSA-N |
| XLogP | 4.00 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|