C22H40O — CID 18640315
cis-(1R,3S)-3-[4-(4-butylcyclohexyl)cyclohexyl]cyclohexan-1-ol (PubChem CID 18640315) has the molecular formula C22H40O and a molecular weight of 320.56 g/mol. Its IUPAC name is cis-(1R,3S)-3-[4-(4-butylcyclohexyl)cyclohexyl]cyclohexan-1-ol.
| Compound Name | cis-(1R,3S)-3-[4-(4-butylcyclohexyl)cyclohexyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 18640315 |
| Molecular Formula | C22H40O |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | cis-(1R,3S)-3-[4-(4-butylcyclohexyl)cyclohexyl]cyclohexan-1-ol |
| SMILES | CCCCC1CCC(C2CCC([C@H]3CCC[C@@H](O)C3)CC2)CC1 |
| InChI | InChI=1S/C22H40O/c1-2-3-5-17-8-10-18(11-9-17)19-12-14-20(15-13-19)21-6-4-7-22(23)16-21/h17-23H,2-16H2,1H3/t17?,18?,19?,20?,21-,22+/m0/s1 |
| InChIKey | JQWYPKDEBJOVKM-YYYKGONBSA-N |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |