About cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol
cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol (PubChem CID 18640317) has the molecular formula C25H46O
and a molecular weight of 362.64 g/mol. Its IUPAC name is cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol |
| PubChem CID | 18640317 |
| Molecular Formula | C25H46O |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.35 |
| IUPAC Name | cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol |
| SMILES | CCCCCCCC1CCC(C2CCC([C@H]3CCC[C@@H](O)C3)CC2)CC1 |
| InChI | InChI=1S/C25H46O/c1-2-3-4-5-6-8-20-11-13-21(14-12-20)22-15-17-23(18-16-22)24-9-7-10-25(26)19-24/h20-26H,2-19H2,1H3/t20?,21?,22?,23?,24-,25+/m0/s1 |
| InChIKey | SLUSRSNZLLVNCQ-KCAONXANSA-N |
| XLogP | 7.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol?
The IUPAC name of cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol (CID 18640317) is cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol.
What is the SMILES notation for cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol?
The canonical SMILES for cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol is CCCCCCCC1CCC(C2CCC([C@H]3CCC[C@@H](O)C3)CC2)CC1.
What is the InChIKey of cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol?
The InChIKey is SLUSRSNZLLVNCQ-KCAONXANSA-N. The full InChI is InChI=1S/C25H46O/c1-2-3-4-5-6-8-20-11-13-21(14-12-20)22-15-17-23(18-16-22)24-9-7-10-25(26)19-24/h20-26H,2-19H2,1H3/t20?,21?,22?,23?,24-,25+/m0/s1.
What are the key properties of cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol?
cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol has a molecular weight of 362.64 g/mol, XLogP of 7.51, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-[4-(4-heptylcyclohexyl)cyclohexyl]cyclohexan-1-ol is sourced from PubChem (CID 18640317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).