C31H32BNO2 — CID 18640443
1-[(2R)-2-(6-methoxynaphthalen-2-yl)propyl]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 18640443) has the molecular formula C31H32BNO2 and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-[(2R)-2-(6-methoxynaphthalen-2-yl)propyl]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | 1-[(2R)-2-(6-methoxynaphthalen-2-yl)propyl]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 18640443 |
| Molecular Formula | C31H32BNO2 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 1-[(2R)-2-(6-methoxynaphthalen-2-yl)propyl]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | COc1ccc2cc([C@H](C)CB3OC(c4ccccc4)(c4ccccc4)C4CCCN34)ccc2c1 |
| InChI | InChI=1S/C31H32BNO2/c1-23(24-15-16-26-21-29(34-2)18-17-25(26)20-24)22-32-33-19-9-14-30(33)31(35-32,27-10-5-3-6-11-27)28-12-7-4-8-13-28/h3-8,10-13,15-18,20-21,23,30H,9,14,19,22H2,1-2H3/t23-,30?/m1/s1 |
| InChIKey | CXQVFENUCJRHPO-ZCQJSQKNSA-N |
| XLogP | 6.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|