C11H19NO5 — CID 18640775
[(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] propanoate (PubChem CID 18640775) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] propanoate.
| Compound Name | [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] propanoate |
|---|---|
| PubChem CID | 18640775 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | [(1S,6S,7R,8R,8aR)-1,6,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](O)[C@H]2[C@@H](O)CCN2C[C@@H]1O |
| InChI | InChI=1S/C11H19NO5/c1-2-8(15)17-11-7(14)5-12-4-3-6(13)9(12)10(11)16/h6-7,9-11,13-14,16H,2-5H2,1H3/t6-,7-,9+,10+,11+/m0/s1 |
| InChIKey | LJIWCNDLCRPDQJ-GOIIVKRLSA-N |
| XLogP | -1.52 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |