C39H32N2 — CID 18641520
N-[(1R)-1-anthracen-9-ylethyl]-7-[(1R)-1-anthracen-9-ylethyl]iminocyclohepta-1,3,5-trien-1-amine (PubChem CID 18641520) has the molecular formula C39H32N2 and a molecular weight of 528.70 g/mol. Its IUPAC name is N-[(1R)-1-anthracen-9-ylethyl]-7-[(1R)-1-anthracen-9-ylethyl]iminocyclohepta-1,3,5-trien-1-amine.
| Compound Name | N-[(1R)-1-anthracen-9-ylethyl]-7-[(1R)-1-anthracen-9-ylethyl]iminocyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 18641520 |
| Molecular Formula | C39H32N2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | N-[(1R)-1-anthracen-9-ylethyl]-7-[(1R)-1-anthracen-9-ylethyl]iminocyclohepta-1,3,5-trien-1-amine |
| SMILES | C[C@@H](/N=c1\cccccc1N[C@H](C)c1c2ccccc2cc2ccccc12)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C39H32N2/c1-26(38-32-18-10-6-14-28(32)24-29-15-7-11-19-33(29)38)40-36-22-4-3-5-23-37(36)41-27(2)39-34-20-12-8-16-30(34)25-31-17-9-13-21-35(31)39/h3-27H,1-2H3,(H,40,41)/t26-,27-/m1/s1 |
| InChIKey | KJOUHBGUMAEQKQ-KAYWLYCHSA-N |
| XLogP | 10.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|