C15H26N2 — CID 18641589
(4R,4aS)-2-ethyl-4-pyrrolidin-1-yl-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline (PubChem CID 18641589) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (4R,4aS)-2-ethyl-4-pyrrolidin-1-yl-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline.
| Compound Name | (4R,4aS)-2-ethyl-4-pyrrolidin-1-yl-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 18641589 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (4R,4aS)-2-ethyl-4-pyrrolidin-1-yl-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline |
| SMILES | CCN1CC2CC=CC[C@@H]2[C@@H](N2CCCC2)C1 |
| InChI | InChI=1S/C15H26N2/c1-2-16-11-13-7-3-4-8-14(13)15(12-16)17-9-5-6-10-17/h3-4,13-15H,2,5-12H2,1H3/t13?,14-,15-/m0/s1 |
| InChIKey | HAKVCKMSHJSVJD-FGRDXJNISA-N |
| XLogP | 2.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|