C17H30O3 — CID 18641674
[(5R)-5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methanol (PubChem CID 18641674) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is [(5R)-5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methanol.
| Compound Name | [(5R)-5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 18641674 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | [(5R)-5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methanol |
| SMILES | C[C@@H]1CCC=C(CO)C1CCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C17H30O3/c1-13-6-5-7-14(10-18)15(13)8-9-17(4)19-11-16(2,3)12-20-17/h7,13,15,18H,5-6,8-12H2,1-4H3/t13-,15?/m1/s1 |
| InChIKey | SSHHSEAPGYFEIO-AFYYWNPRSA-N |
| XLogP | 3.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|