About (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde
(2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 18641861) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 18641861 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | C[C@H](N)C(=O)O.O=CC1=CCCC=C1 |
| InChI | InChI=1S/C7H8O.C3H7NO2/c8-6-7-4-2-1-3-5-7;1-2(4)3(5)6/h2,4-6H,1,3H2;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | BOPDMVSDQZMIDS-WNQIDUERSA-N |
| XLogP | 0.88 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde (CID 18641861) is (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde is C[C@H](N)C(=O)O.O=CC1=CCCC=C1.
What is the InChIKey of (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is BOPDMVSDQZMIDS-WNQIDUERSA-N. The full InChI is InChI=1S/C7H8O.C3H7NO2/c8-6-7-4-2-1-3-5-7;1-2(4)3(5)6/h2,4-6H,1,3H2;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde?
(2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 197.23 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;cyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 18641861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).