C32H56O5Si — CID 18641959
[(1S,4aS,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,3,7-trimethyl-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 18641959) has the molecular formula C32H56O5Si and a molecular weight of 548.88 g/mol. Its IUPAC name is [(1S,4aS,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,3,7-trimethyl-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,4aS,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,3,7-trimethyl-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 18641959 |
| Molecular Formula | C32H56O5Si |
| Molecular Weight | 548.88 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | [(1S,4aS,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,3,7-trimethyl-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1CC(C)(C)C[C@H]2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@@H]21 |
| InChI | InChI=1S/C32H56O5Si/c1-12-32(8,9)29(34)36-26-20-31(6,7)19-22-14-13-21(2)25(28(22)26)16-15-23-17-24(18-27(33)35-23)37-38(10,11)30(3,4)5/h13-14,21-26,28H,12,15-20H2,1-11H3/t21-,22+,23+,24+,25-,26-,28+/m0/s1 |
| InChIKey | VWBVWTYILZPFHP-OGZWHUTMSA-N |
| XLogP | 8.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.88 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|