C21H34O6 — CID 18642504
methyl 2,2-dihydroxy-7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-4-oxoheptanoate (PubChem CID 18642504) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl 2,2-dihydroxy-7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-4-oxoheptanoate.
| Compound Name | methyl 2,2-dihydroxy-7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-4-oxoheptanoate |
|---|---|
| PubChem CID | 18642504 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | methyl 2,2-dihydroxy-7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-4-oxoheptanoate |
| SMILES | CCCCCC/C=C/[C@H]1CCC(=O)[C@@H]1CCCC(=O)CC(O)(O)C(=O)OC |
| InChI | InChI=1S/C21H34O6/c1-3-4-5-6-7-8-10-16-13-14-19(23)18(16)12-9-11-17(22)15-21(25,26)20(24)27-2/h8,10,16,18,25-26H,3-7,9,11-15H2,1-2H3/b10-8+/t16-,18+/m0/s1 |
| InChIKey | GRMHSWGOVAISMF-IDNNPUCFSA-N |
| XLogP | 3.09 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|