About prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate
prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 18642551) has the molecular formula C13H20FNO4S
and a molecular weight of 305.37 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 18642551 |
| Molecular Formula | C13H20FNO4S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(C)=O)C[C@H]1COCCF |
| InChI | InChI=1S/C13H20FNO4S/c1-3-5-19-13(17)15-8-12(20-10(2)16)7-11(15)9-18-6-4-14/h3,11-12H,1,4-9H2,2H3/t11-,12-/m0/s1 |
| InChIKey | IPYCOLHLAWXIHI-RYUDHWBXSA-N |
| XLogP | 2.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate (CID 18642551) is prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1C[C@@H](SC(C)=O)C[C@H]1COCCF.
What is the InChIKey of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is IPYCOLHLAWXIHI-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H20FNO4S/c1-3-5-19-13(17)15-8-12(20-10(2)16)7-11(15)9-18-6-4-14/h3,11-12H,1,4-9H2,2H3/t11-,12-/m0/s1.
What are the key properties of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate?
prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 305.37 g/mol, XLogP of 2.02, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 18642551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).