About prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate
prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 18642554) has the molecular formula C15H24FNO4S
and a molecular weight of 333.43 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 18642554 |
| Molecular Formula | C15H24FNO4S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(C)=O)C[C@H]1COCCCCF |
| InChI | InChI=1S/C15H24FNO4S/c1-3-7-21-15(19)17-10-14(22-12(2)18)9-13(17)11-20-8-5-4-6-16/h3,13-14H,1,4-11H2,2H3/t13-,14-/m0/s1 |
| InChIKey | VEPSOVMUKGQINR-KBPBESRZSA-N |
| XLogP | 2.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate (CID 18642554) is prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1C[C@@H](SC(C)=O)C[C@H]1COCCCCF.
What is the InChIKey of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is VEPSOVMUKGQINR-KBPBESRZSA-N. The full InChI is InChI=1S/C15H24FNO4S/c1-3-7-21-15(19)17-10-14(22-12(2)18)9-13(17)11-20-8-5-4-6-16/h3,13-14H,1,4-11H2,2H3/t13-,14-/m0/s1.
What are the key properties of prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate?
prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 333.43 g/mol, XLogP of 2.80, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(4-fluorobutoxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 18642554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).