About [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate
[(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate (PubChem CID 18642570) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate.
Molecular Properties
| Compound Name | [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate |
| PubChem CID | 18642570 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate |
| SMILES | CC[C@H]1C(=O)N[C@H]1COC(=O)[C@H](OC)c1ccccc1 |
| InChI | InChI=1S/C15H19NO4/c1-3-11-12(16-14(11)17)9-20-15(18)13(19-2)10-7-5-4-6-8-10/h4-8,11-13H,3,9H2,1-2H3,(H,16,17)/t11-,12+,13-/m1/s1 |
| InChIKey | SFPMEWYBEIXUHD-FRRDWIJNSA-N |
| XLogP | 1.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate?
The IUPAC name of [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate (CID 18642570) is [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate.
What is the SMILES notation for [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate?
The canonical SMILES for [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate is CC[C@H]1C(=O)N[C@H]1COC(=O)[C@H](OC)c1ccccc1.
What is the InChIKey of [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate?
The InChIKey is SFPMEWYBEIXUHD-FRRDWIJNSA-N. The full InChI is InChI=1S/C15H19NO4/c1-3-11-12(16-14(11)17)9-20-15(18)13(19-2)10-7-5-4-6-8-10/h4-8,11-13H,3,9H2,1-2H3,(H,16,17)/t11-,12+,13-/m1/s1.
What are the key properties of [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate?
[(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate has a molecular weight of 277.32 g/mol, XLogP of 1.44, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-3-ethyl-4-oxoazetidin-2-yl]methyl (2R)-2-methoxy-2-phenylacetate is sourced from PubChem (CID 18642570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).