C22H37FO4 — CID 18642946
(Z)-7-[(1R,2S,3R)-3-fluoro-2-[(E)-4-methyloct-1-enyl]cyclopentyl]-2,2-dihydroxy-6-methylhept-5-enoic acid (PubChem CID 18642946) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R)-3-fluoro-2-[(E)-4-methyloct-1-enyl]cyclopentyl]-2,2-dihydroxy-6-methylhept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R)-3-fluoro-2-[(E)-4-methyloct-1-enyl]cyclopentyl]-2,2-dihydroxy-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 18642946 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (Z)-7-[(1R,2S,3R)-3-fluoro-2-[(E)-4-methyloct-1-enyl]cyclopentyl]-2,2-dihydroxy-6-methylhept-5-enoic acid |
| SMILES | CCCCC(C)C/C=C/[C@@H]1[C@@H](C/C(C)=C\CCC(O)(O)C(=O)O)CC[C@H]1F |
| InChI | InChI=1S/C22H37FO4/c1-4-5-8-16(2)9-6-11-19-18(12-13-20(19)23)15-17(3)10-7-14-22(26,27)21(24)25/h6,10-11,16,18-20,26-27H,4-5,7-9,12-15H2,1-3H3,(H,24,25)/b11-6+,17-10-/t16?,18-,19-,20-/m1/s1 |
| InChIKey | PFZOOZIIUVSPKD-MQVWDFKISA-N |
| XLogP | 5.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|