About [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid
[(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid (PubChem CID 18642989) has the molecular formula C17H29NO4
and a molecular weight of 311.42 g/mol. Its IUPAC name is [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid |
| PubChem CID | 18642989 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid |
| SMILES | CCC(C)[C@@H]1C[C@@H]([C@H](CC2CCCCC2)NC(=O)O)OC1=O |
| InChI | InChI=1S/C17H29NO4/c1-3-11(2)13-10-15(22-16(13)19)14(18-17(20)21)9-12-7-5-4-6-8-12/h11-15,18H,3-10H2,1-2H3,(H,20,21)/t11?,13-,14-,15-/m0/s1 |
| InChIKey | YAUBYFRKGFQEKF-JZKRNLGJSA-N |
| XLogP | 3.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid?
The IUPAC name of [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid (CID 18642989) is [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid.
What is the SMILES notation for [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid?
The canonical SMILES for [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid is CCC(C)[C@@H]1C[C@@H]([C@H](CC2CCCCC2)NC(=O)O)OC1=O.
What is the InChIKey of [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid?
The InChIKey is YAUBYFRKGFQEKF-JZKRNLGJSA-N. The full InChI is InChI=1S/C17H29NO4/c1-3-11(2)13-10-15(22-16(13)19)14(18-17(20)21)9-12-7-5-4-6-8-12/h11-15,18H,3-10H2,1-2H3,(H,20,21)/t11?,13-,14-,15-/m0/s1.
What are the key properties of [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid?
[(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid has a molecular weight of 311.42 g/mol, XLogP of 3.57, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[(2S,4S)-4-butan-2-yl-5-oxooxolan-2-yl]-2-cyclohexylethyl]carbamic acid is sourced from PubChem (CID 18642989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).