C25H31N — CID 18643171
4-propyl-1-[4-(4-propylphenyl)phenyl]cyclohexane-1-carbonitrile (PubChem CID 18643171) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is 4-propyl-1-[4-(4-propylphenyl)phenyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-propyl-1-[4-(4-propylphenyl)phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18643171 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 4-propyl-1-[4-(4-propylphenyl)phenyl]cyclohexane-1-carbonitrile |
| SMILES | CCCc1ccc(-c2ccc(C3(C#N)CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H31N/c1-3-5-20-7-9-22(10-8-20)23-11-13-24(14-12-23)25(19-26)17-15-21(6-4-2)16-18-25/h7-14,21H,3-6,15-18H2,1-2H3 |
| InChIKey | VDMOIPYSCYNLSF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |