C12H22O6 — CID 18643460
(4S,5S,6S,7S)-2,9-dimethyldeca-2,8-diene-3,4,5,6,7,8-hexol (PubChem CID 18643460) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is (4S,5S,6S,7S)-2,9-dimethyldeca-2,8-diene-3,4,5,6,7,8-hexol.
| Compound Name | (4S,5S,6S,7S)-2,9-dimethyldeca-2,8-diene-3,4,5,6,7,8-hexol |
|---|---|
| PubChem CID | 18643460 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (4S,5S,6S,7S)-2,9-dimethyldeca-2,8-diene-3,4,5,6,7,8-hexol |
| SMILES | CC(C)=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=C(C)C |
| InChI | InChI=1S/C12H22O6/c1-5(2)7(13)9(15)11(17)12(18)10(16)8(14)6(3)4/h9-18H,1-4H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | PHJIZHSZHXTTCK-DDHJBXDOSA-N |
| XLogP | 0.13 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|