C15H16N4O2S — CID 18643517
methyl N-cyano-N'-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]carbamimidothioate (PubChem CID 18643517) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is methyl N-cyano-N'-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]carbamimidothioate |
|---|---|
| PubChem CID | 18643517 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | methyl N-cyano-N'-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]carbamimidothioate |
| SMILES | CS/C(=N\[C@@H]1c2cc(C#N)ccc2OC(C)(C)[C@H]1O)NC#N |
| InChI | InChI=1S/C15H16N4O2S/c1-15(2)13(20)12(19-14(22-3)18-8-17)10-6-9(7-16)4-5-11(10)21-15/h4-6,12-13,20H,1-3H3,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | YAXSVRLJOSEFJE-OLZOCXBDSA-N |
| XLogP | 1.92 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|