About (Z)-2-propoxybut-2-ene
(Z)-2-propoxybut-2-ene (PubChem CID 18643584) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is (Z)-2-propoxybut-2-ene.
Molecular Properties
| Compound Name | (Z)-2-propoxybut-2-ene |
| PubChem CID | 18643584 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | (Z)-2-propoxybut-2-ene |
| SMILES | C/C=C(/C)OCCC |
| InChI | InChI=1S/C7H14O/c1-4-6-8-7(3)5-2/h5H,4,6H2,1-3H3/b7-5- |
| InChIKey | GHFHTNIBFKBDKH-ALCCZGGFSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-propoxybut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-propoxybut-2-ene?
The IUPAC name of (Z)-2-propoxybut-2-ene (CID 18643584) is (Z)-2-propoxybut-2-ene.
What is the SMILES notation for (Z)-2-propoxybut-2-ene?
The canonical SMILES for (Z)-2-propoxybut-2-ene is C/C=C(/C)OCCC.
What is the InChIKey of (Z)-2-propoxybut-2-ene?
The InChIKey is GHFHTNIBFKBDKH-ALCCZGGFSA-N. The full InChI is InChI=1S/C7H14O/c1-4-6-8-7(3)5-2/h5H,4,6H2,1-3H3/b7-5-.
What are the key properties of (Z)-2-propoxybut-2-ene?
(Z)-2-propoxybut-2-ene has a molecular weight of 114.19 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-propoxybut-2-ene is sourced from PubChem (CID 18643584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).