C31H46O11S2Si — CID 18643693
[(4S,5S)-5-[(S)-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfonyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 18643693) has the molecular formula C31H46O11S2Si and a molecular weight of 686.92 g/mol. Its IUPAC name is [(4S,5S)-5-[(S)-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfonyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(4S,5S)-5-[(S)-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfonyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 18643693 |
| Molecular Formula | C31H46O11S2Si |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.23 |
| IUPAC Name | [(4S,5S)-5-[(S)-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfonyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@H]([C@@H](OS(C)(=O)=O)[C@@H]2OC(C)(C)O[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C31H46O11S2Si/c1-29(2,3)45(22-16-12-10-13-17-22,23-18-14-11-15-19-23)37-21-25-27(41-31(6,7)39-25)28(42-44(9,34)35)26-24(20-36-43(8,32)33)38-30(4,5)40-26/h10-19,24-28H,20-21H2,1-9H3/t24-,25-,26-,27+,28+/m0/s1 |
| InChIKey | MGCZSUPVGRKVKS-APNLASKRSA-N |
| XLogP | 2.92 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|