C25H28FN3O5 — CID 18643808
N-[[(3R,4S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methoxypiperidin-4-yl]methoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 18643808) has the molecular formula C25H28FN3O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is N-[[(3R,4S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methoxypiperidin-4-yl]methoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | N-[[(3R,4S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methoxypiperidin-4-yl]methoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18643808 |
| Molecular Formula | C25H28FN3O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[[(3R,4S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-methoxypiperidin-4-yl]methoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | CO[C@H]1CN(CCN2C(=O)c3ccccc3C2=O)CC[C@H]1CON(C(C)=O)c1ccccc1F |
| InChI | InChI=1S/C25H28FN3O5/c1-17(30)29(22-10-6-5-9-21(22)26)34-16-18-11-12-27(15-23(18)33-2)13-14-28-24(31)19-7-3-4-8-20(19)25(28)32/h3-10,18,23H,11-16H2,1-2H3/t18-,23-/m0/s1 |
| InChIKey | QSIQIWSZDKPYKH-MBSDFSHPSA-N |
| XLogP | 2.74 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|